C25H46O7Si2 — CID 86182095
1-[4-methyl-2,6-bis(2-triethoxysilylethyl)phenyl]ethanone (PubChem CID 86182095) has the molecular formula C25H46O7Si2 and a molecular weight of 514.81 g/mol. Its IUPAC name is 1-[4-methyl-2,6-bis(2-triethoxysilylethyl)phenyl]ethanone.
| Compound Name | 1-[4-methyl-2,6-bis(2-triethoxysilylethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 86182095 |
| Molecular Formula | C25H46O7Si2 |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 1-[4-methyl-2,6-bis(2-triethoxysilylethyl)phenyl]ethanone |
| SMILES | CCO[Si](CCc1cc(C)cc(CC[Si](OCC)(OCC)OCC)c1C(C)=O)(OCC)OCC |
| InChI | InChI=1S/C25H46O7Si2/c1-9-27-33(28-10-2,29-11-3)17-15-23-19-21(7)20-24(25(23)22(8)26)16-18-34(30-12-4,31-13-5)32-14-6/h19-20H,9-18H2,1-8H3 |
| InChIKey | WHLBOCJMCRUFEI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|