C28H36N2O2 — CID 86183417
2,5-bis(4-hexoxyphenyl)pyrazine (PubChem CID 86183417) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2,5-bis(4-hexoxyphenyl)pyrazine.
| Compound Name | 2,5-bis(4-hexoxyphenyl)pyrazine |
|---|---|
| PubChem CID | 86183417 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 2,5-bis(4-hexoxyphenyl)pyrazine |
| SMILES | CCCCCCOc1ccc(-c2cnc(-c3ccc(OCCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H36N2O2/c1-3-5-7-9-19-31-25-15-11-23(12-16-25)27-21-30-28(22-29-27)24-13-17-26(18-14-24)32-20-10-8-6-4-2/h11-18,21-22H,3-10,19-20H2,1-2H3 |
| InChIKey | RBRGUILIJLFCOC-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|