About ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate
ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate (PubChem CID 86183573) has the molecular formula C10H18O3S2
and a molecular weight of 250.38 g/mol. Its IUPAC name is ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate |
| PubChem CID | 86183573 |
| Molecular Formula | C10H18O3S2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate |
| SMILES | CCOC(=O)C1(CCOC)SCCCS1 |
| InChI | InChI=1S/C10H18O3S2/c1-3-13-9(11)10(5-6-12-2)14-7-4-8-15-10/h3-8H2,1-2H3 |
| InChIKey | FISFYHDIOHDHCF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate?
The IUPAC name of ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate (CID 86183573) is ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate.
What is the SMILES notation for ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate?
The canonical SMILES for ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate is CCOC(=O)C1(CCOC)SCCCS1.
What is the InChIKey of ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate?
The InChIKey is FISFYHDIOHDHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S2/c1-3-13-9(11)10(5-6-12-2)14-7-4-8-15-10/h3-8H2,1-2H3.
What are the key properties of ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate?
ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate has a molecular weight of 250.38 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-methoxyethyl)-1,3-dithiane-2-carboxylate is sourced from PubChem (CID 86183573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).