C12H20N6O2 — CID 86184126
3-ethyl-4-[4-(3-ethyl-5-oxo-1H-1,2,4-triazol-4-yl)butyl]-1H-1,2,4-triazol-5-one (PubChem CID 86184126) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-ethyl-4-[4-(3-ethyl-5-oxo-1H-1,2,4-triazol-4-yl)butyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-ethyl-4-[4-(3-ethyl-5-oxo-1H-1,2,4-triazol-4-yl)butyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 86184126 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-ethyl-4-[4-(3-ethyl-5-oxo-1H-1,2,4-triazol-4-yl)butyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCc1n[nH]c(=O)n1CCCCn1c(CC)n[nH]c1=O |
| InChI | InChI=1S/C12H20N6O2/c1-3-9-13-15-11(19)17(9)7-5-6-8-18-10(4-2)14-16-12(18)20/h3-8H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | PEDHYDHHOVMQMA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|