About 7-fluoro-2,3-dimethyl-5H-1-benzazepine
7-fluoro-2,3-dimethyl-5H-1-benzazepine (PubChem CID 86184736) has the molecular formula C12H12FN
and a molecular weight of 189.23 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-5H-1-benzazepine.
Molecular Properties
| Compound Name | 7-fluoro-2,3-dimethyl-5H-1-benzazepine |
| PubChem CID | 86184736 |
| Molecular Formula | C12H12FN |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-5H-1-benzazepine |
| SMILES | CC1=CCc2cc(F)ccc2N=C1C |
| InChI | InChI=1S/C12H12FN/c1-8-3-4-10-7-11(13)5-6-12(10)14-9(8)2/h3,5-7H,4H2,1-2H3 |
| InChIKey | ITYYKMUDAVQOHP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-2,3-dimethyl-5H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-dimethyl-5H-1-benzazepine?
The IUPAC name of 7-fluoro-2,3-dimethyl-5H-1-benzazepine (CID 86184736) is 7-fluoro-2,3-dimethyl-5H-1-benzazepine.
What is the SMILES notation for 7-fluoro-2,3-dimethyl-5H-1-benzazepine?
The canonical SMILES for 7-fluoro-2,3-dimethyl-5H-1-benzazepine is CC1=CCc2cc(F)ccc2N=C1C.
What is the InChIKey of 7-fluoro-2,3-dimethyl-5H-1-benzazepine?
The InChIKey is ITYYKMUDAVQOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN/c1-8-3-4-10-7-11(13)5-6-12(10)14-9(8)2/h3,5-7H,4H2,1-2H3.
What are the key properties of 7-fluoro-2,3-dimethyl-5H-1-benzazepine?
7-fluoro-2,3-dimethyl-5H-1-benzazepine has a molecular weight of 189.23 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dimethyl-5H-1-benzazepine is sourced from PubChem (CID 86184736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).