About 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane
7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane (PubChem CID 86185317) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane.
Molecular Properties
| Compound Name | 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane |
| PubChem CID | 86185317 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCC1CC2CCCN2C2CCCN12 |
| InChI | InChI=1S/C13H24N2/c1-2-5-11-10-12-6-3-8-15(12)13-7-4-9-14(11)13/h11-13H,2-10H2,1H3 |
| InChIKey | VJJWHOBPDFRQRH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane?
The IUPAC name of 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane (CID 86185317) is 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane.
What is the SMILES notation for 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane?
The canonical SMILES for 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane is CCCC1CC2CCCN2C2CCCN12.
What is the InChIKey of 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane?
The InChIKey is VJJWHOBPDFRQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-2-5-11-10-12-6-3-8-15(12)13-7-4-9-14(11)13/h11-13H,2-10H2,1H3.
What are the key properties of 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane?
7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane has a molecular weight of 208.35 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propyl-1,6-diazatricyclo[7.3.0.02,6]dodecane is sourced from PubChem (CID 86185317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).