C16H15N3O3 — CID 86185538
5-methyl-2-(4-nitrophenyl)-3-phenyl-4H-pyrazol-3-ol (PubChem CID 86185538) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-methyl-2-(4-nitrophenyl)-3-phenyl-4H-pyrazol-3-ol.
| Compound Name | 5-methyl-2-(4-nitrophenyl)-3-phenyl-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 86185538 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-methyl-2-(4-nitrophenyl)-3-phenyl-4H-pyrazol-3-ol |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15N3O3/c1-12-11-16(20,13-5-3-2-4-6-13)18(17-12)14-7-9-15(10-8-14)19(21)22/h2-10,20H,11H2,1H3 |
| InChIKey | FWGIOMWXYFKLQL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|