About 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione
3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione (PubChem CID 86185888) has the molecular formula C16H11NO2S
and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione.
Molecular Properties
| Compound Name | 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione |
| PubChem CID | 86185888 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione |
| SMILES | CN1c2ccccc2SC12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11NO2S/c1-17-12-8-4-5-9-13(12)20-16(17)14(18)10-6-2-3-7-11(10)15(16)19/h2-9H,1H3 |
| InChIKey | VWEGNCJNRSHXFC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione?
The IUPAC name of 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione (CID 86185888) is 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione.
What is the SMILES notation for 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione?
The canonical SMILES for 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione is CN1c2ccccc2SC12C(=O)c1ccccc1C2=O.
What is the InChIKey of 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione?
The InChIKey is VWEGNCJNRSHXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2S/c1-17-12-8-4-5-9-13(12)20-16(17)14(18)10-6-2-3-7-11(10)15(16)19/h2-9H,1H3.
What are the key properties of 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione?
3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione has a molecular weight of 281.34 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[1,3-benzothiazole-2,2'-indene]-1',3'-dione is sourced from PubChem (CID 86185888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).