C6H5F7OS — CID 86186090
1,1,2,2-tetrafluoro-1-methylsulfanyl-3-(1,2,2-trifluoroethenoxy)propane (PubChem CID 86186090) has the molecular formula C6H5F7OS and a molecular weight of 258.16 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-methylsulfanyl-3-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 1,1,2,2-tetrafluoro-1-methylsulfanyl-3-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 86186090 |
| Molecular Formula | C6H5F7OS |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-methylsulfanyl-3-(1,2,2-trifluoroethenoxy)propane |
| SMILES | CSC(F)(F)C(F)(F)COC(F)=C(F)F |
| InChI | InChI=1S/C6H5F7OS/c1-15-6(12,13)5(10,11)2-14-4(9)3(7)8/h2H2,1H3 |
| InChIKey | WXJLPTJAENDYHE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|