About 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene
2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene (PubChem CID 86188414) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene |
| PubChem CID | 86188414 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene |
| SMILES | CC1(CC2CCCCC2)CCc2ccccc2O1 |
| InChI | InChI=1S/C17H24O/c1-17(13-14-7-3-2-4-8-14)12-11-15-9-5-6-10-16(15)18-17/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3 |
| InChIKey | RVYVQNMKUNLKML-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene?
The IUPAC name of 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene (CID 86188414) is 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene.
What is the SMILES notation for 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene?
The canonical SMILES for 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene is CC1(CC2CCCCC2)CCc2ccccc2O1.
What is the InChIKey of 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene?
The InChIKey is RVYVQNMKUNLKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-17(13-14-7-3-2-4-8-14)12-11-15-9-5-6-10-16(15)18-17/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3.
What are the key properties of 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene?
2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene has a molecular weight of 244.38 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethyl)-2-methyl-3,4-dihydrochromene is sourced from PubChem (CID 86188414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).