About 3-bromo-4,5-dimethylcyclohex-2-en-1-one
3-bromo-4,5-dimethylcyclohex-2-en-1-one (PubChem CID 86189490) has the molecular formula C8H11BrO
and a molecular weight of 203.08 g/mol. Its IUPAC name is 3-bromo-4,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-bromo-4,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 86189490 |
| Molecular Formula | C8H11BrO |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 3-bromo-4,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1CC(=O)C=C(Br)C1C |
| InChI | InChI=1S/C8H11BrO/c1-5-3-7(10)4-8(9)6(5)2/h4-6H,3H2,1-2H3 |
| InChIKey | CIFGXLHENOEZRH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-4,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-bromo-4,5-dimethylcyclohex-2-en-1-one (CID 86189490) is 3-bromo-4,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-bromo-4,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-bromo-4,5-dimethylcyclohex-2-en-1-one is CC1CC(=O)C=C(Br)C1C.
What is the InChIKey of 3-bromo-4,5-dimethylcyclohex-2-en-1-one?
The InChIKey is CIFGXLHENOEZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO/c1-5-3-7(10)4-8(9)6(5)2/h4-6H,3H2,1-2H3.
What are the key properties of 3-bromo-4,5-dimethylcyclohex-2-en-1-one?
3-bromo-4,5-dimethylcyclohex-2-en-1-one has a molecular weight of 203.08 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 86189490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).