About 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol
5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol (PubChem CID 86191561) has the molecular formula C8H12BrNOS
and a molecular weight of 250.16 g/mol. Its IUPAC name is 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol |
| PubChem CID | 86191561 |
| Molecular Formula | C8H12BrNOS |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol |
| SMILES | OCCCCCc1nc(Br)cs1 |
| InChI | InChI=1S/C8H12BrNOS/c9-7-6-12-8(10-7)4-2-1-3-5-11/h6,11H,1-5H2 |
| InChIKey | HXOLNHXXJDMHBU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol?
The IUPAC name of 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol (CID 86191561) is 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol.
What is the SMILES notation for 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol?
The canonical SMILES for 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol is OCCCCCc1nc(Br)cs1.
What is the InChIKey of 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol?
The InChIKey is HXOLNHXXJDMHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrNOS/c9-7-6-12-8(10-7)4-2-1-3-5-11/h6,11H,1-5H2.
What are the key properties of 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol?
5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol has a molecular weight of 250.16 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol is sourced from PubChem (CID 86191561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).