C8H12BrNOS — CID 86191561
5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol (PubChem CID 86191561) has the molecular formula C8H12BrNOS and a molecular weight of 250.16 g/mol. Its IUPAC name is 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol.
| Compound Name | 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 86191561 |
| Molecular Formula | C8H12BrNOS |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 5-(4-bromo-1,3-thiazol-2-yl)pentan-1-ol |
| SMILES | OCCCCCc1nc(Br)cs1 |
| InChI | InChI=1S/C8H12BrNOS/c9-7-6-12-8(10-7)4-2-1-3-5-11/h6,11H,1-5H2 |
| InChIKey | HXOLNHXXJDMHBU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|