C10H9ClN2O2 — CID 86191712
4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,2-oxazol-3-one (PubChem CID 86191712) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,2-oxazol-3-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 86191712 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,2-oxazol-3-one |
| SMILES | Cc1o[nH]c(=O)c1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-6-8(10(14)13-15-6)4-7-2-3-9(11)12-5-7/h2-3,5H,4H2,1H3,(H,13,14) |
| InChIKey | PSQXBNSIFCEQSY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|