C22H21FO5S2 — CID 86193920
1-[3,3-bis(benzenesulfonyl)-1-fluoropropyl]-4-methoxybenzene (PubChem CID 86193920) has the molecular formula C22H21FO5S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-[3,3-bis(benzenesulfonyl)-1-fluoropropyl]-4-methoxybenzene.
| Compound Name | 1-[3,3-bis(benzenesulfonyl)-1-fluoropropyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 86193920 |
| Molecular Formula | C22H21FO5S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-[3,3-bis(benzenesulfonyl)-1-fluoropropyl]-4-methoxybenzene |
| SMILES | COc1ccc(C(F)CC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21FO5S2/c1-28-18-14-12-17(13-15-18)21(23)16-22(29(24,25)19-8-4-2-5-9-19)30(26,27)20-10-6-3-7-11-20/h2-15,21-22H,16H2,1H3 |
| InChIKey | QWJHXLHEZFNETM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |