About 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione
1,4-bis(2-ethylhexyl)piperazine-2,3-dithione (PubChem CID 86194653) has the molecular formula C20H38N2S2
and a molecular weight of 370.67 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione.
Molecular Properties
| Compound Name | 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione |
| PubChem CID | 86194653 |
| Molecular Formula | C20H38N2S2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione |
| SMILES | CCCCC(CC)CN1CCN(CC(CC)CCCC)C(=S)C1=S |
| InChI | InChI=1S/C20H38N2S2/c1-5-9-11-17(7-3)15-21-13-14-22(20(24)19(21)23)16-18(8-4)12-10-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | CDNGBKQXBILWLS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione?
The IUPAC name of 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione (CID 86194653) is 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione.
What is the SMILES notation for 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione?
The canonical SMILES for 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione is CCCCC(CC)CN1CCN(CC(CC)CCCC)C(=S)C1=S.
What is the InChIKey of 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione?
The InChIKey is CDNGBKQXBILWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N2S2/c1-5-9-11-17(7-3)15-21-13-14-22(20(24)19(21)23)16-18(8-4)12-10-6-2/h17-18H,5-16H2,1-4H3.
What are the key properties of 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione?
1,4-bis(2-ethylhexyl)piperazine-2,3-dithione has a molecular weight of 370.67 g/mol, XLogP of 5.69, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(2-ethylhexyl)piperazine-2,3-dithione is sourced from PubChem (CID 86194653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).