About 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea
1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea (PubChem CID 8619513) has the molecular formula C10H9F2N5S2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea.
Molecular Properties
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea |
| PubChem CID | 8619513 |
| Molecular Formula | C10H9F2N5S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C10H9F2N5S2/c11-9(12)19-8-3-1-7(2-4-8)15-10(18)16-17-5-13-14-6-17/h1-6,9H,(H2,15,16,18) |
| InChIKey | NFUDJVLTGWNCMF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea?
The IUPAC name of 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea (CID 8619513) is 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea.
What is the SMILES notation for 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea?
The canonical SMILES for 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea is FC(F)Sc1ccc(NC(=S)Nn2cnnc2)cc1.
What is the InChIKey of 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea?
The InChIKey is NFUDJVLTGWNCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N5S2/c11-9(12)19-8-3-1-7(2-4-8)15-10(18)16-17-5-13-14-6-17/h1-6,9H,(H2,15,16,18).
What are the key properties of 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea?
1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea has a molecular weight of 301.35 g/mol, XLogP of 2.53, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1,2,4-triazol-4-yl)thiourea is sourced from PubChem (CID 8619513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).