About N-butyl-N,2-dimethylbut-3-en-1-amine
N-butyl-N,2-dimethylbut-3-en-1-amine (PubChem CID 86196430) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is N-butyl-N,2-dimethylbut-3-en-1-amine.
Molecular Properties
| Compound Name | N-butyl-N,2-dimethylbut-3-en-1-amine |
| PubChem CID | 86196430 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N-butyl-N,2-dimethylbut-3-en-1-amine |
| SMILES | C=CC(C)CN(C)CCCC |
| InChI | InChI=1S/C10H21N/c1-5-7-8-11(4)9-10(3)6-2/h6,10H,2,5,7-9H2,1,3-4H3 |
| InChIKey | JHVLTENOQPNLDY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N,2-dimethylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,2-dimethylbut-3-en-1-amine?
The IUPAC name of N-butyl-N,2-dimethylbut-3-en-1-amine (CID 86196430) is N-butyl-N,2-dimethylbut-3-en-1-amine.
What is the SMILES notation for N-butyl-N,2-dimethylbut-3-en-1-amine?
The canonical SMILES for N-butyl-N,2-dimethylbut-3-en-1-amine is C=CC(C)CN(C)CCCC.
What is the InChIKey of N-butyl-N,2-dimethylbut-3-en-1-amine?
The InChIKey is JHVLTENOQPNLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-5-7-8-11(4)9-10(3)6-2/h6,10H,2,5,7-9H2,1,3-4H3.
What are the key properties of N-butyl-N,2-dimethylbut-3-en-1-amine?
N-butyl-N,2-dimethylbut-3-en-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,2-dimethylbut-3-en-1-amine is sourced from PubChem (CID 86196430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).