About 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol
5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol (PubChem CID 86200896) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol.
Molecular Properties
| Compound Name | 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol |
| PubChem CID | 86200896 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol |
| SMILES | Cc1c2c(c3ccccc3c1O)OCCS2 |
| InChI | InChI=1S/C13H12O2S/c1-8-11(14)9-4-2-3-5-10(9)12-13(8)16-7-6-15-12/h2-5,14H,6-7H2,1H3 |
| InChIKey | OQIJUAPUGRZIPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol?
The IUPAC name of 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol (CID 86200896) is 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol.
What is the SMILES notation for 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol?
The canonical SMILES for 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol is Cc1c2c(c3ccccc3c1O)OCCS2.
What is the InChIKey of 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol?
The InChIKey is OQIJUAPUGRZIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S/c1-8-11(14)9-4-2-3-5-10(9)12-13(8)16-7-6-15-12/h2-5,14H,6-7H2,1H3.
What are the key properties of 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol?
5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol has a molecular weight of 232.30 g/mol, XLogP of 3.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydrobenzo[h][1,4]benzoxathiin-6-ol is sourced from PubChem (CID 86200896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).