About 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene
3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene (PubChem CID 86201623) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene.
Analyze 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The IUPAC name of 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene (CID 86201623) is 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene.
What is the SMILES notation for 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The canonical SMILES for 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene is Cc1c(C)c(C)c2c(c1C)C1CCC2CC1.
What is the InChIKey of 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The InChIKey is JPWLZGABHCBBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22/c1-9-10(2)12(4)16-14-7-5-13(6-8-14)15(16)11(9)3/h13-14H,5-8H2,1-4H3.
What are the key properties of 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene has a molecular weight of 214.35 g/mol, XLogP of 4.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetramethyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene is sourced from PubChem (CID 86201623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).