C14H19NO4S — CID 86202356
1-azabicyclo[2.2.2]octan-3-one;4-methylbenzenesulfonic acid (PubChem CID 86202356) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86202356 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-one;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C1CN2CCC1CC2 |
| InChI | InChI=1S/C7H11NO.C7H8O3S/c9-7-5-8-3-1-6(7)2-4-8;1-6-2-4-7(5-3-6)11(8,9)10/h6H,1-5H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | LHQSPLRHEMMENJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|