C10H15FN2 — CID 86202491
N,N-diethyl-3-fluoro-3H-azepin-2-amine (PubChem CID 86202491) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is N,N-diethyl-3-fluoro-3H-azepin-2-amine.
| Compound Name | N,N-diethyl-3-fluoro-3H-azepin-2-amine |
|---|---|
| PubChem CID | 86202491 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N,N-diethyl-3-fluoro-3H-azepin-2-amine |
| SMILES | CCN(CC)C1=NC=CC=CC1F |
| InChI | InChI=1S/C10H15FN2/c1-3-13(4-2)10-9(11)7-5-6-8-12-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | BPVJKMQDAGABTK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |