About ethyl 2-hydrazinylideneacetate
ethyl 2-hydrazinylideneacetate (PubChem CID 86202640) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is ethyl 2-hydrazinylideneacetate.
Molecular Properties
| Compound Name | ethyl 2-hydrazinylideneacetate |
| PubChem CID | 86202640 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | ethyl 2-hydrazinylideneacetate |
| SMILES | CCOC(=O)C=NN |
| InChI | InChI=1S/C4H8N2O2/c1-2-8-4(7)3-6-5/h3H,2,5H2,1H3 |
| InChIKey | JKMKOJBCEVGASO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydrazinylideneacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydrazinylideneacetate?
The IUPAC name of ethyl 2-hydrazinylideneacetate (CID 86202640) is ethyl 2-hydrazinylideneacetate.
What is the SMILES notation for ethyl 2-hydrazinylideneacetate?
The canonical SMILES for ethyl 2-hydrazinylideneacetate is CCOC(=O)C=NN.
What is the InChIKey of ethyl 2-hydrazinylideneacetate?
The InChIKey is JKMKOJBCEVGASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c1-2-8-4(7)3-6-5/h3H,2,5H2,1H3.
What are the key properties of ethyl 2-hydrazinylideneacetate?
ethyl 2-hydrazinylideneacetate has a molecular weight of 116.12 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydrazinylideneacetate is sourced from PubChem (CID 86202640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).