C14H16N2O — CID 86202974
N,N-diethylisoquinoline-5-carboxamide (PubChem CID 86202974) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N,N-diethylisoquinoline-5-carboxamide.
| Compound Name | N,N-diethylisoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 86202974 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N,N-diethylisoquinoline-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C14H16N2O/c1-3-16(4-2)14(17)13-7-5-6-11-10-15-9-8-12(11)13/h5-10H,3-4H2,1-2H3 |
| InChIKey | GVZNMGAGOXGOKM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |