About 5-cyclohexyl-1,1,1-trifluoropentan-2-one
5-cyclohexyl-1,1,1-trifluoropentan-2-one (PubChem CID 86203039) has the molecular formula C11H17F3O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 5-cyclohexyl-1,1,1-trifluoropentan-2-one.
Molecular Properties
| Compound Name | 5-cyclohexyl-1,1,1-trifluoropentan-2-one |
| PubChem CID | 86203039 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5-cyclohexyl-1,1,1-trifluoropentan-2-one |
| SMILES | O=C(CCCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c12-11(13,14)10(15)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2 |
| InChIKey | AIUFQUIWJSRDLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexyl-1,1,1-trifluoropentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1,1,1-trifluoropentan-2-one?
The IUPAC name of 5-cyclohexyl-1,1,1-trifluoropentan-2-one (CID 86203039) is 5-cyclohexyl-1,1,1-trifluoropentan-2-one.
What is the SMILES notation for 5-cyclohexyl-1,1,1-trifluoropentan-2-one?
The canonical SMILES for 5-cyclohexyl-1,1,1-trifluoropentan-2-one is O=C(CCCC1CCCCC1)C(F)(F)F.
What is the InChIKey of 5-cyclohexyl-1,1,1-trifluoropentan-2-one?
The InChIKey is AIUFQUIWJSRDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O/c12-11(13,14)10(15)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2.
What are the key properties of 5-cyclohexyl-1,1,1-trifluoropentan-2-one?
5-cyclohexyl-1,1,1-trifluoropentan-2-one has a molecular weight of 222.25 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,1,1-trifluoropentan-2-one is sourced from PubChem (CID 86203039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).