C8H12F3NO2S — CID 86204611
1,1,1-trifluoro-N-hepta-5,6-dienylmethanesulfonamide (PubChem CID 86204611) has the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-hepta-5,6-dienylmethanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-hepta-5,6-dienylmethanesulfonamide |
|---|---|
| PubChem CID | 86204611 |
| Molecular Formula | C8H12F3NO2S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1,1,1-trifluoro-N-hepta-5,6-dienylmethanesulfonamide |
| SMILES | C=C=CCCCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2S/c1-2-3-4-5-6-7-12-15(13,14)8(9,10)11/h3,12H,1,4-7H2 |
| InChIKey | RSHINFCAGICDBR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|