About diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate
diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate (PubChem CID 86204980) has the molecular formula C30H28N2Se2
and a molecular weight of 574.49 g/mol. Its IUPAC name is diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate.
Molecular Properties
| Compound Name | diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate |
| PubChem CID | 86204980 |
| Molecular Formula | C30H28N2Se2 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate |
| SMILES | Cc1cccc(C)c1/N=C([Se]c1ccccc1)/C(=N\c1c(C)cccc1C)[Se]c1ccccc1 |
| InChI | InChI=1S/C30H28N2Se2/c1-21-13-11-14-22(2)27(21)31-29(33-25-17-7-5-8-18-25)30(34-26-19-9-6-10-20-26)32-28-23(3)15-12-16-24(28)4/h5-20H,1-4H3/b31-29-,32-30+ |
| InChIKey | WAWVJBRDGFBHCH-SNQKRLHOSA-N |
| XLogP | 5.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate?
The IUPAC name of diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate (CID 86204980) is diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate.
What is the SMILES notation for diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate?
The canonical SMILES for diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate is Cc1cccc(C)c1/N=C([Se]c1ccccc1)/C(=N\c1c(C)cccc1C)[Se]c1ccccc1.
What is the InChIKey of diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate?
The InChIKey is WAWVJBRDGFBHCH-SNQKRLHOSA-N. The full InChI is InChI=1S/C30H28N2Se2/c1-21-13-11-14-22(2)27(21)31-29(33-25-17-7-5-8-18-25)30(34-26-19-9-6-10-20-26)32-28-23(3)15-12-16-24(28)4/h5-20H,1-4H3/b31-29-,32-30+.
What are the key properties of diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate?
diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate has a molecular weight of 574.49 g/mol, XLogP of 5.74, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl N,N'-bis(2,6-dimethylphenyl)ethanediimidoselenoate is sourced from PubChem (CID 86204980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).