C24H20N2O2 — CID 86205937
4-(2,2-diphenylacetyl)-5-methyl-2-phenyl-4H-pyrazol-3-one (PubChem CID 86205937) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-(2,2-diphenylacetyl)-5-methyl-2-phenyl-4H-pyrazol-3-one.
| Compound Name | 4-(2,2-diphenylacetyl)-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 86205937 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(2,2-diphenylacetyl)-5-methyl-2-phenyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O2/c1-17-21(24(28)26(25-17)20-15-9-4-10-16-20)23(27)22(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,21-22H,1H3 |
| InChIKey | ZIHKHGQDOIYXKA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|