C7H9F7O3 — CID 86206067
3-(2,2,3,3,4,4,4-heptafluorobutoxy)propane-1,2-diol (PubChem CID 86206067) has the molecular formula C7H9F7O3 and a molecular weight of 274.13 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,4-heptafluorobutoxy)propane-1,2-diol.
| Compound Name | 3-(2,2,3,3,4,4,4-heptafluorobutoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 86206067 |
| Molecular Formula | C7H9F7O3 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 3-(2,2,3,3,4,4,4-heptafluorobutoxy)propane-1,2-diol |
| SMILES | OCC(O)COCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F7O3/c8-5(9,3-17-2-4(16)1-15)6(10,11)7(12,13)14/h4,15-16H,1-3H2 |
| InChIKey | PYNBSVWCXUUDTG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|