About 2H-pyrimido[5,4-e][1,3]thiazine
2H-pyrimido[5,4-e][1,3]thiazine (PubChem CID 86206244) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 2H-pyrimido[5,4-e][1,3]thiazine.
Molecular Properties
| Compound Name | 2H-pyrimido[5,4-e][1,3]thiazine |
| PubChem CID | 86206244 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 2H-pyrimido[5,4-e][1,3]thiazine |
| SMILES | C1=NCSc2ncncc21 |
| InChI | InChI=1S/C6H5N3S/c1-5-2-8-4-10-6(5)9-3-7-1/h1-3H,4H2 |
| InChIKey | ZWFKFQWZOSEZLZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyrimido[5,4-e][1,3]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimido[5,4-e][1,3]thiazine?
The IUPAC name of 2H-pyrimido[5,4-e][1,3]thiazine (CID 86206244) is 2H-pyrimido[5,4-e][1,3]thiazine.
What is the SMILES notation for 2H-pyrimido[5,4-e][1,3]thiazine?
The canonical SMILES for 2H-pyrimido[5,4-e][1,3]thiazine is C1=NCSc2ncncc21.
What is the InChIKey of 2H-pyrimido[5,4-e][1,3]thiazine?
The InChIKey is ZWFKFQWZOSEZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c1-5-2-8-4-10-6(5)9-3-7-1/h1-3H,4H2.
What are the key properties of 2H-pyrimido[5,4-e][1,3]thiazine?
2H-pyrimido[5,4-e][1,3]thiazine has a molecular weight of 151.19 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimido[5,4-e][1,3]thiazine is sourced from PubChem (CID 86206244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).