About 1,3-dihydropyrido[1,2-c][1,3]oxazine
1,3-dihydropyrido[1,2-c][1,3]oxazine (PubChem CID 86206363) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,3-dihydropyrido[1,2-c][1,3]oxazine.
Molecular Properties
| Compound Name | 1,3-dihydropyrido[1,2-c][1,3]oxazine |
| PubChem CID | 86206363 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 1,3-dihydropyrido[1,2-c][1,3]oxazine |
| SMILES | C1=CC2=CCOCN2C=C1 |
| InChI | InChI=1S/C8H9NO/c1-2-5-9-7-10-6-4-8(9)3-1/h1-5H,6-7H2 |
| InChIKey | JJWDACXLBPOFDY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dihydropyrido[1,2-c][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydropyrido[1,2-c][1,3]oxazine?
The IUPAC name of 1,3-dihydropyrido[1,2-c][1,3]oxazine (CID 86206363) is 1,3-dihydropyrido[1,2-c][1,3]oxazine.
What is the SMILES notation for 1,3-dihydropyrido[1,2-c][1,3]oxazine?
The canonical SMILES for 1,3-dihydropyrido[1,2-c][1,3]oxazine is C1=CC2=CCOCN2C=C1.
What is the InChIKey of 1,3-dihydropyrido[1,2-c][1,3]oxazine?
The InChIKey is JJWDACXLBPOFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-2-5-9-7-10-6-4-8(9)3-1/h1-5H,6-7H2.
What are the key properties of 1,3-dihydropyrido[1,2-c][1,3]oxazine?
1,3-dihydropyrido[1,2-c][1,3]oxazine has a molecular weight of 135.17 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydropyrido[1,2-c][1,3]oxazine is sourced from PubChem (CID 86206363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).