C24H26N4O3 — CID 86207634
N-[1-(1-methylbenzimidazol-2-yl)ethyl]-3-(3-methyl-2,5-dioxo-3-phenylpyrrolidin-1-yl)propanamide (PubChem CID 86207634) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[1-(1-methylbenzimidazol-2-yl)ethyl]-3-(3-methyl-2,5-dioxo-3-phenylpyrrolidin-1-yl)propanamide.
| Compound Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]-3-(3-methyl-2,5-dioxo-3-phenylpyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 86207634 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]-3-(3-methyl-2,5-dioxo-3-phenylpyrrolidin-1-yl)propanamide |
| SMILES | CC(NC(=O)CCN1C(=O)CC(C)(c2ccccc2)C1=O)c1nc2ccccc2n1C |
| InChI | InChI=1S/C24H26N4O3/c1-16(22-26-18-11-7-8-12-19(18)27(22)3)25-20(29)13-14-28-21(30)15-24(2,23(28)31)17-9-5-4-6-10-17/h4-12,16H,13-15H2,1-3H3,(H,25,29) |
| InChIKey | RMCSAUHZZJMGGX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|