C19H19N3S — CID 86207830
N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-4,6-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 86207830) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-4,6-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-4,6-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 86207830 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-4,6-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(C)c2nc(N/N=C3\CCCc4ccccc43)sc2c1 |
| InChI | InChI=1S/C19H19N3S/c1-12-10-13(2)18-17(11-12)23-19(20-18)22-21-16-9-5-7-14-6-3-4-8-15(14)16/h3-4,6,8,10-11H,5,7,9H2,1-2H3,(H,20,22)/b21-16+ |
| InChIKey | UEEAGCQGMFFQIH-LTGZKZEYSA-N |
| XLogP | 5.07 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|