[3-(4-methylpyrazol-1-yl)phenyl]boronic acid

C10H11BN2O2 — CID 86208031

IUPAC[3-(4-methylpyrazol-1-yl)phenyl]boronic acid
SMILESCc1cnn(-c2cccc(B(O)O)c2)c1
InChIInChI=1S/C10H11BN2O2/c1-8-6-12-13(7-8)10-4-2-3-9(5-10)11(14)15/h2-7,14-15H,1H3
InChIKeyALUPGYPYXASNLN-UHFFFAOYSA-N
MW202.02 g/mol
LogP-0.14
Rot. Bonds2

About [3-(4-methylpyrazol-1-yl)phenyl]boronic acid

[3-(4-methylpyrazol-1-yl)phenyl]boronic acid (PubChem CID 86208031) has the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. Its IUPAC name is [3-(4-methylpyrazol-1-yl)phenyl]boronic acid.

Molecular Properties

Compound Name[3-(4-methylpyrazol-1-yl)phenyl]boronic acid
PubChem CID86208031
Molecular FormulaC10H11BN2O2
Molecular Weight202.02 g/mol
Exact Mass202.09
IUPAC Name[3-(4-methylpyrazol-1-yl)phenyl]boronic acid
SMILESCc1cnn(-c2cccc(B(O)O)c2)c1
InChIInChI=1S/C10H11BN2O2/c1-8-6-12-13(7-8)10-4-2-3-9(5-10)11(14)15/h2-7,14-15H,1H3
InChIKeyALUPGYPYXASNLN-UHFFFAOYSA-N
XLogP-0.14
TPSA58.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.02
LogP ≤ 5-0.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-(4-methylpyrazol-1-yl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(4-methylpyrazol-1-yl)phenyl]boronic acid?
The IUPAC name of [3-(4-methylpyrazol-1-yl)phenyl]boronic acid (CID 86208031) is [3-(4-methylpyrazol-1-yl)phenyl]boronic acid.
What is the SMILES notation for [3-(4-methylpyrazol-1-yl)phenyl]boronic acid?
The canonical SMILES for [3-(4-methylpyrazol-1-yl)phenyl]boronic acid is Cc1cnn(-c2cccc(B(O)O)c2)c1.
What is the InChIKey of [3-(4-methylpyrazol-1-yl)phenyl]boronic acid?
The InChIKey is ALUPGYPYXASNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BN2O2/c1-8-6-12-13(7-8)10-4-2-3-9(5-10)11(14)15/h2-7,14-15H,1H3.
What are the key properties of [3-(4-methylpyrazol-1-yl)phenyl]boronic acid?
[3-(4-methylpyrazol-1-yl)phenyl]boronic acid has a molecular weight of 202.02 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methylpyrazol-1-yl)phenyl]boronic acid is sourced from PubChem (CID 86208031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).