C26H16Cl4N2 — CID 86208216
1-(2,6-dichlorophenyl)-N-[2-[2-[(2,6-dichlorophenyl)methylideneamino]phenyl]phenyl]methanimine (PubChem CID 86208216) has the molecular formula C26H16Cl4N2 and a molecular weight of 498.24 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[2-[2-[(2,6-dichlorophenyl)methylideneamino]phenyl]phenyl]methanimine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[2-[2-[(2,6-dichlorophenyl)methylideneamino]phenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 86208216 |
| Molecular Formula | C26H16Cl4N2 |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[2-[2-[(2,6-dichlorophenyl)methylideneamino]phenyl]phenyl]methanimine |
| SMILES | Clc1cccc(Cl)c1/C=N/c1ccccc1-c1ccccc1/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H16Cl4N2/c27-21-9-5-10-22(28)19(21)15-31-25-13-3-1-7-17(25)18-8-2-4-14-26(18)32-16-20-23(29)11-6-12-24(20)30/h1-16H/b31-15+,32-16+ |
| InChIKey | BYAYKICBPFLPPJ-IHXWQEJPSA-N |
| XLogP | 9.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|