About 1-bromobut-3-yn-2-one
1-bromobut-3-yn-2-one (PubChem CID 86208730) has the molecular formula C4H3BrO
and a molecular weight of 146.97 g/mol. Its IUPAC name is 1-bromobut-3-yn-2-one.
Molecular Properties
| Compound Name | 1-bromobut-3-yn-2-one |
| PubChem CID | 86208730 |
| Molecular Formula | C4H3BrO |
| Molecular Weight | 146.97 g/mol |
| Exact Mass | 145.94 |
| IUPAC Name | 1-bromobut-3-yn-2-one |
| SMILES | C#CC(=O)CBr |
| InChI | InChI=1S/C4H3BrO/c1-2-4(6)3-5/h1H,3H2 |
| InChIKey | FHYCMARVUCYRQU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.97 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromobut-3-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromobut-3-yn-2-one?
The IUPAC name of 1-bromobut-3-yn-2-one (CID 86208730) is 1-bromobut-3-yn-2-one.
What is the SMILES notation for 1-bromobut-3-yn-2-one?
The canonical SMILES for 1-bromobut-3-yn-2-one is C#CC(=O)CBr.
What is the InChIKey of 1-bromobut-3-yn-2-one?
The InChIKey is FHYCMARVUCYRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3BrO/c1-2-4(6)3-5/h1H,3H2.
What are the key properties of 1-bromobut-3-yn-2-one?
1-bromobut-3-yn-2-one has a molecular weight of 146.97 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromobut-3-yn-2-one is sourced from PubChem (CID 86208730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).