About 1,2-difluorochrysene
1,2-difluorochrysene (PubChem CID 86208925) has the molecular formula C18H10F2
and a molecular weight of 264.27 g/mol. Its IUPAC name is 1,2-difluorochrysene.
Molecular Properties
| Compound Name | 1,2-difluorochrysene |
| PubChem CID | 86208925 |
| Molecular Formula | C18H10F2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1,2-difluorochrysene |
| SMILES | Fc1ccc2c(ccc3c4ccccc4ccc23)c1F |
| InChI | InChI=1S/C18H10F2/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20/h1-10H |
| InChIKey | NPARIHLPAWOJKR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluorochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluorochrysene?
The IUPAC name of 1,2-difluorochrysene (CID 86208925) is 1,2-difluorochrysene.
What is the SMILES notation for 1,2-difluorochrysene?
The canonical SMILES for 1,2-difluorochrysene is Fc1ccc2c(ccc3c4ccccc4ccc23)c1F.
What is the InChIKey of 1,2-difluorochrysene?
The InChIKey is NPARIHLPAWOJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F2/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20/h1-10H.
What are the key properties of 1,2-difluorochrysene?
1,2-difluorochrysene has a molecular weight of 264.27 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluorochrysene is sourced from PubChem (CID 86208925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).