C10H8Br4O2 — CID 86209268
4,5,7-tribromo-6-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole (PubChem CID 86209268) has the molecular formula C10H8Br4O2 and a molecular weight of 479.79 g/mol. Its IUPAC name is 4,5,7-tribromo-6-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole.
| Compound Name | 4,5,7-tribromo-6-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 86209268 |
| Molecular Formula | C10H8Br4O2 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 475.73 |
| IUPAC Name | 4,5,7-tribromo-6-(bromomethyl)-2,2-dimethyl-1,3-benzodioxole |
| SMILES | CC1(C)Oc2c(Br)c(Br)c(CBr)c(Br)c2O1 |
| InChI | InChI=1S/C10H8Br4O2/c1-10(2)15-8-6(13)4(3-11)5(12)7(14)9(8)16-10/h3H2,1-2H3 |
| InChIKey | XOAWWZHUKLNSLE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|