About 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one
3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one (PubChem CID 86209565) has the molecular formula C8H9N2O+
and a molecular weight of 149.17 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one |
| PubChem CID | 86209565 |
| Molecular Formula | C8H9N2O+ |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one |
| SMILES | O=C1NCC[n+]2ccccc21 |
| InChI | InChI=1S/C8H8N2O/c11-8-7-3-1-2-5-10(7)6-4-9-8/h1-3,5H,4,6H2/p+1 |
| InChIKey | LCIXSECGVFWZKB-UHFFFAOYSA-O |
| XLogP | -0.28 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one?
The IUPAC name of 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one (CID 86209565) is 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one.
What is the SMILES notation for 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one?
The canonical SMILES for 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one is O=C1NCC[n+]2ccccc21.
What is the InChIKey of 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one?
The InChIKey is LCIXSECGVFWZKB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8N2O/c11-8-7-3-1-2-5-10(7)6-4-9-8/h1-3,5H,4,6H2/p+1.
What are the key properties of 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one?
3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one has a molecular weight of 149.17 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrido[1,2-a]pyrazin-5-ium-1-one is sourced from PubChem (CID 86209565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).