About N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine
N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine (PubChem CID 86211262) has the molecular formula C27H29N3O3
and a molecular weight of 443.55 g/mol. Its IUPAC name is N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 86211262 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2oc3ncnc(NC4CCCCCC4)c3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-31-21-13-9-18(10-14-21)23-24-26(30-20-7-5-3-4-6-8-20)28-17-29-27(24)33-25(23)19-11-15-22(32-2)16-12-19/h9-17,20H,3-8H2,1-2H3,(H,28,29,30) |
| InChIKey | XMJRCGDCLZVEFD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine (CID 86211262) is N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine is COc1ccc(-c2oc3ncnc(NC4CCCCCC4)c3c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine?
The InChIKey is XMJRCGDCLZVEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O3/c1-31-21-13-9-18(10-14-21)23-24-26(30-20-7-5-3-4-6-8-20)28-17-29-27(24)33-25(23)19-11-15-22(32-2)16-12-19/h9-17,20H,3-8H2,1-2H3,(H,28,29,30).
What are the key properties of N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine?
N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine has a molecular weight of 443.55 g/mol, XLogP of 6.71, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 86211262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).