C14H21NO — CID 86212480
2-hexyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 86212480) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-hexyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2-hexyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 86212480 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-hexyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCCCCCC1CNc2ccccc2O1 |
| InChI | InChI=1S/C14H21NO/c1-2-3-4-5-8-12-11-15-13-9-6-7-10-14(13)16-12/h6-7,9-10,12,15H,2-5,8,11H2,1H3 |
| InChIKey | QLBWXUVWRGIZBC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|