About 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane
4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane (PubChem CID 86212923) has the molecular formula C21H34OSi
and a molecular weight of 330.59 g/mol. Its IUPAC name is 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane.
Molecular Properties
| Compound Name | 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane |
| PubChem CID | 86212923 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCCC(C)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C21H34OSi/c1-5-23(6-2,7-3)22-18-12-17-21(4,19-13-8-9-14-19)20-15-10-11-16-20/h8-11,13-16,19-20H,5-7,12,17-18H2,1-4H3 |
| InChIKey | PXSZGHKCUAFRMD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane?
The IUPAC name of 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane (CID 86212923) is 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane.
What is the SMILES notation for 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane?
The canonical SMILES for 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane is CC[Si](CC)(CC)OCCCC(C)(C1C=CC=C1)C1C=CC=C1.
What is the InChIKey of 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane?
The InChIKey is PXSZGHKCUAFRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34OSi/c1-5-23(6-2,7-3)22-18-12-17-21(4,19-13-8-9-14-19)20-15-10-11-16-20/h8-11,13-16,19-20H,5-7,12,17-18H2,1-4H3.
What are the key properties of 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane?
4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane has a molecular weight of 330.59 g/mol, XLogP of 6.28, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane is sourced from PubChem (CID 86212923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).