About 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane]
3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] (PubChem CID 86213224) has the molecular formula C9H11BrO
and a molecular weight of 215.09 g/mol. Its IUPAC name is 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane].
Molecular Properties
| Compound Name | 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] |
| PubChem CID | 86213224 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] |
| SMILES | BrCC1OC12CC1C=CC2C1 |
| InChI | InChI=1S/C9H11BrO/c10-5-8-9(11-8)4-6-1-2-7(9)3-6/h1-2,6-8H,3-5H2 |
| InChIKey | QULHSNPPOLCBIN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane]?
The IUPAC name of 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] (CID 86213224) is 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane].
What is the SMILES notation for 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane]?
The canonical SMILES for 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] is BrCC1OC12CC1C=CC2C1.
What is the InChIKey of 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane]?
The InChIKey is QULHSNPPOLCBIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO/c10-5-8-9(11-8)4-6-1-2-7(9)3-6/h1-2,6-8H,3-5H2.
What are the key properties of 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane]?
3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] has a molecular weight of 215.09 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(bromomethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,2'-oxirane] is sourced from PubChem (CID 86213224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).