C14H12BrNO2 — CID 86213594
5-(3-bromofuran-2-yl)-N-methoxy-2,3-dihydroinden-1-imine (PubChem CID 86213594) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 5-(3-bromofuran-2-yl)-N-methoxy-2,3-dihydroinden-1-imine.
| Compound Name | 5-(3-bromofuran-2-yl)-N-methoxy-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 86213594 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-(3-bromofuran-2-yl)-N-methoxy-2,3-dihydroinden-1-imine |
| SMILES | CON=C1CCc2cc(-c3occc3Br)ccc21 |
| InChI | InChI=1S/C14H12BrNO2/c1-17-16-13-5-3-9-8-10(2-4-11(9)13)14-12(15)6-7-18-14/h2,4,6-8H,3,5H2,1H3 |
| InChIKey | MJEWXEOOCFDGQM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|