About 2-(5,5-difluoropent-4-enoxy)oxane
2-(5,5-difluoropent-4-enoxy)oxane (PubChem CID 86214933) has the molecular formula C10H16F2O2
and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-(5,5-difluoropent-4-enoxy)oxane.
Molecular Properties
| Compound Name | 2-(5,5-difluoropent-4-enoxy)oxane |
| PubChem CID | 86214933 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(5,5-difluoropent-4-enoxy)oxane |
| SMILES | FC(F)=CCCCOC1CCCCO1 |
| InChI | InChI=1S/C10H16F2O2/c11-9(12)5-1-3-7-13-10-6-2-4-8-14-10/h5,10H,1-4,6-8H2 |
| InChIKey | VUFZFSZGQUKOIS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-difluoropent-4-enoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-difluoropent-4-enoxy)oxane?
The IUPAC name of 2-(5,5-difluoropent-4-enoxy)oxane (CID 86214933) is 2-(5,5-difluoropent-4-enoxy)oxane.
What is the SMILES notation for 2-(5,5-difluoropent-4-enoxy)oxane?
The canonical SMILES for 2-(5,5-difluoropent-4-enoxy)oxane is FC(F)=CCCCOC1CCCCO1.
What is the InChIKey of 2-(5,5-difluoropent-4-enoxy)oxane?
The InChIKey is VUFZFSZGQUKOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O2/c11-9(12)5-1-3-7-13-10-6-2-4-8-14-10/h5,10H,1-4,6-8H2.
What are the key properties of 2-(5,5-difluoropent-4-enoxy)oxane?
2-(5,5-difluoropent-4-enoxy)oxane has a molecular weight of 206.23 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-difluoropent-4-enoxy)oxane is sourced from PubChem (CID 86214933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).