About 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole
5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole (PubChem CID 86214980) has the molecular formula C10H6Cl3NO2S2
and a molecular weight of 342.66 g/mol. Its IUPAC name is 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole |
| PubChem CID | 86214980 |
| Molecular Formula | C10H6Cl3NO2S2 |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole |
| SMILES | O=S(=O)(Cc1c(Cl)cccc1Cl)c1ncc(Cl)s1 |
| InChI | InChI=1S/C10H6Cl3NO2S2/c11-7-2-1-3-8(12)6(7)5-18(15,16)10-14-4-9(13)17-10/h1-4H,5H2 |
| InChIKey | DHBBIGSKXOHSIA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole?
The IUPAC name of 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole (CID 86214980) is 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole.
What is the SMILES notation for 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole?
The canonical SMILES for 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole is O=S(=O)(Cc1c(Cl)cccc1Cl)c1ncc(Cl)s1.
What is the InChIKey of 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole?
The InChIKey is DHBBIGSKXOHSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl3NO2S2/c11-7-2-1-3-8(12)6(7)5-18(15,16)10-14-4-9(13)17-10/h1-4H,5H2.
What are the key properties of 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole?
5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole has a molecular weight of 342.66 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(2,6-dichlorophenyl)methylsulfonyl]-1,3-thiazole is sourced from PubChem (CID 86214980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).