About 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine
3-nitropyridin-2-amine;5-nitropyrimidin-2-amine (PubChem CID 86215059) has the molecular formula C9H9N7O4
and a molecular weight of 279.22 g/mol. Its IUPAC name is 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine.
Molecular Properties
| Compound Name | 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine |
| PubChem CID | 86215059 |
| Molecular Formula | C9H9N7O4 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine |
| SMILES | Nc1ncc([N+](=O)[O-])cn1.Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H5N3O2.C4H4N4O2/c6-5-4(8(9)10)2-1-3-7-5;5-4-6-1-3(2-7-4)8(9)10/h1-3H,(H2,6,7);1-2H,(H2,5,6,7) |
| InChIKey | IVMSRDOOEQCNNM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 176.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine?
The IUPAC name of 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine (CID 86215059) is 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine.
What is the SMILES notation for 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine?
The canonical SMILES for 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine is Nc1ncc([N+](=O)[O-])cn1.Nc1ncccc1[N+](=O)[O-].
What is the InChIKey of 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine?
The InChIKey is IVMSRDOOEQCNNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2.C4H4N4O2/c6-5-4(8(9)10)2-1-3-7-5;5-4-6-1-3(2-7-4)8(9)10/h1-3H,(H2,6,7);1-2H,(H2,5,6,7).
What are the key properties of 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine?
3-nitropyridin-2-amine;5-nitropyrimidin-2-amine has a molecular weight of 279.22 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropyridin-2-amine;5-nitropyrimidin-2-amine is sourced from PubChem (CID 86215059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).