About 4-ethenylideneoctan-3-ol
4-ethenylideneoctan-3-ol (PubChem CID 86216185) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 4-ethenylideneoctan-3-ol.
Molecular Properties
| Compound Name | 4-ethenylideneoctan-3-ol |
| PubChem CID | 86216185 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 4-ethenylideneoctan-3-ol |
| SMILES | C=C=C(CCCC)C(O)CC |
| InChI | InChI=1S/C10H18O/c1-4-7-8-9(5-2)10(11)6-3/h10-11H,2,4,6-8H2,1,3H3 |
| InChIKey | HSOMOMVJQDZIRE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenylideneoctan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylideneoctan-3-ol?
The IUPAC name of 4-ethenylideneoctan-3-ol (CID 86216185) is 4-ethenylideneoctan-3-ol.
What is the SMILES notation for 4-ethenylideneoctan-3-ol?
The canonical SMILES for 4-ethenylideneoctan-3-ol is C=C=C(CCCC)C(O)CC.
What is the InChIKey of 4-ethenylideneoctan-3-ol?
The InChIKey is HSOMOMVJQDZIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-4-7-8-9(5-2)10(11)6-3/h10-11H,2,4,6-8H2,1,3H3.
What are the key properties of 4-ethenylideneoctan-3-ol?
4-ethenylideneoctan-3-ol has a molecular weight of 154.25 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylideneoctan-3-ol is sourced from PubChem (CID 86216185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).