About 1-(4-iodophenyl)-2,3-dihydropyridin-6-one
1-(4-iodophenyl)-2,3-dihydropyridin-6-one (PubChem CID 86216746) has the molecular formula C11H10INO
and a molecular weight of 299.11 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-(4-iodophenyl)-2,3-dihydropyridin-6-one |
| PubChem CID | 86216746 |
| Molecular Formula | C11H10INO |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 1-(4-iodophenyl)-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1c1ccc(I)cc1 |
| InChI | InChI=1S/C11H10INO/c12-9-4-6-10(7-5-9)13-8-2-1-3-11(13)14/h1,3-7H,2,8H2 |
| InChIKey | WUIHATHGOKSGOW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodophenyl)-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodophenyl)-2,3-dihydropyridin-6-one?
The IUPAC name of 1-(4-iodophenyl)-2,3-dihydropyridin-6-one (CID 86216746) is 1-(4-iodophenyl)-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-(4-iodophenyl)-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-(4-iodophenyl)-2,3-dihydropyridin-6-one is O=C1C=CCCN1c1ccc(I)cc1.
What is the InChIKey of 1-(4-iodophenyl)-2,3-dihydropyridin-6-one?
The InChIKey is WUIHATHGOKSGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10INO/c12-9-4-6-10(7-5-9)13-8-2-1-3-11(13)14/h1,3-7H,2,8H2.
What are the key properties of 1-(4-iodophenyl)-2,3-dihydropyridin-6-one?
1-(4-iodophenyl)-2,3-dihydropyridin-6-one has a molecular weight of 299.11 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodophenyl)-2,3-dihydropyridin-6-one is sourced from PubChem (CID 86216746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).