About 1,1-difluoro-4,8-dimethylnonane
1,1-difluoro-4,8-dimethylnonane (PubChem CID 86217087) has the molecular formula C11H22F2
and a molecular weight of 192.29 g/mol. Its IUPAC name is 1,1-difluoro-4,8-dimethylnonane.
Molecular Properties
| Compound Name | 1,1-difluoro-4,8-dimethylnonane |
| PubChem CID | 86217087 |
| Molecular Formula | C11H22F2 |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | 1,1-difluoro-4,8-dimethylnonane |
| SMILES | CC(C)CCCC(C)CCC(F)F |
| InChI | InChI=1S/C11H22F2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h9-11H,4-8H2,1-3H3 |
| InChIKey | IOPQRLZLGQCOSW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoro-4,8-dimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-4,8-dimethylnonane?
The IUPAC name of 1,1-difluoro-4,8-dimethylnonane (CID 86217087) is 1,1-difluoro-4,8-dimethylnonane.
What is the SMILES notation for 1,1-difluoro-4,8-dimethylnonane?
The canonical SMILES for 1,1-difluoro-4,8-dimethylnonane is CC(C)CCCC(C)CCC(F)F.
What is the InChIKey of 1,1-difluoro-4,8-dimethylnonane?
The InChIKey is IOPQRLZLGQCOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2/c1-9(2)5-4-6-10(3)7-8-11(12)13/h9-11H,4-8H2,1-3H3.
What are the key properties of 1,1-difluoro-4,8-dimethylnonane?
1,1-difluoro-4,8-dimethylnonane has a molecular weight of 192.29 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-4,8-dimethylnonane is sourced from PubChem (CID 86217087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).