About 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol
4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol (PubChem CID 86218651) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol.
Molecular Properties
| Compound Name | 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol |
| PubChem CID | 86218651 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol |
| SMILES | C=CC1(O)CCCc2sccc21 |
| InChI | InChI=1S/C10H12OS/c1-2-10(11)6-3-4-9-8(10)5-7-12-9/h2,5,7,11H,1,3-4,6H2 |
| InChIKey | KUJCNPUQFWUEEX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol?
The IUPAC name of 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol (CID 86218651) is 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol.
What is the SMILES notation for 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol?
The canonical SMILES for 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol is C=CC1(O)CCCc2sccc21.
What is the InChIKey of 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol?
The InChIKey is KUJCNPUQFWUEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-2-10(11)6-3-4-9-8(10)5-7-12-9/h2,5,7,11H,1,3-4,6H2.
What are the key properties of 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol?
4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol has a molecular weight of 180.27 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol is sourced from PubChem (CID 86218651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).